C16H23FN2S2 — CID 100689537
1-(3-cyclohexylsulfanylpropyl)-3-(3-fluorophenyl)thiourea (PubChem CID 100689537) has the molecular formula C16H23FN2S2 and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-(3-cyclohexylsulfanylpropyl)-3-(3-fluorophenyl)thiourea.
| Compound Name | 1-(3-cyclohexylsulfanylpropyl)-3-(3-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 100689537 |
| Molecular Formula | C16H23FN2S2 |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-(3-cyclohexylsulfanylpropyl)-3-(3-fluorophenyl)thiourea |
| SMILES | Fc1cccc(NC(=S)NCCCSC2CCCCC2)c1 |
| InChI | InChI=1S/C16H23FN2S2/c17-13-6-4-7-14(12-13)19-16(20)18-10-5-11-21-15-8-2-1-3-9-15/h4,6-7,12,15H,1-3,5,8-11H2,(H2,18,19,20) |
| InChIKey | KVRRXVLZMYEUBM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|