C16H25N3S2 — CID 100690118
1-(3-cyclohexylsulfanylpropyl)-3-(6-methyl-2-pyridinyl)thiourea (PubChem CID 100690118) has the molecular formula C16H25N3S2 and a molecular weight of 323.53 g/mol. Its IUPAC name is 1-(3-cyclohexylsulfanylpropyl)-3-(6-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-(3-cyclohexylsulfanylpropyl)-3-(6-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100690118 |
| Molecular Formula | C16H25N3S2 |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-(3-cyclohexylsulfanylpropyl)-3-(6-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NCCCSC2CCCCC2)n1 |
| InChI | InChI=1S/C16H25N3S2/c1-13-7-5-10-15(18-13)19-16(20)17-11-6-12-21-14-8-3-2-4-9-14/h5,7,10,14H,2-4,6,8-9,11-12H2,1H3,(H2,17,18,19,20) |
| InChIKey | REJQJPKRBVKSQL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|