C18H29N3O2S3 — CID 100689630
1-(3-cyclohexylsulfanylpropyl)-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea (PubChem CID 100689630) has the molecular formula C18H29N3O2S3 and a molecular weight of 415.65 g/mol. Its IUPAC name is 1-(3-cyclohexylsulfanylpropyl)-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea.
| Compound Name | 1-(3-cyclohexylsulfanylpropyl)-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 100689630 |
| Molecular Formula | C18H29N3O2S3 |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-(3-cyclohexylsulfanylpropyl)-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
| SMILES | CN(c1cccc(NC(=S)NCCCSC2CCCCC2)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H29N3O2S3/c1-21(26(2,22)23)16-9-6-8-15(14-16)20-18(24)19-12-7-13-25-17-10-4-3-5-11-17/h6,8-9,14,17H,3-5,7,10-13H2,1-2H3,(H2,19,20,24) |
| InChIKey | UJEAEXWAPAPJLO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|