C13H21N3O2S2 — CID 100607309
1-butyl-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea (PubChem CID 100607309) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-butyl-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea.
| Compound Name | 1-butyl-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 100607309 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-butyl-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
| SMILES | CCCCNC(=S)Nc1cccc(N(C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H21N3O2S2/c1-4-5-9-14-13(19)15-11-7-6-8-12(10-11)16(2)20(3,17)18/h6-8,10H,4-5,9H2,1-3H3,(H2,14,15,19) |
| InChIKey | FSOJKNJUEUISTQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|