C20H27N3O4S2 — CID 100703468
1-[3-(3,4-dimethoxyphenyl)propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea (PubChem CID 100703468) has the molecular formula C20H27N3O4S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 100703468 |
| Molecular Formula | C20H27N3O4S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
| SMILES | COc1ccc(CCCNC(=S)Nc2cccc(N(C)S(C)(=O)=O)c2)cc1OC |
| InChI | InChI=1S/C20H27N3O4S2/c1-23(29(4,24)25)17-9-5-8-16(14-17)22-20(28)21-12-6-7-15-10-11-18(26-2)19(13-15)27-3/h5,8-11,13-14H,6-7,12H2,1-4H3,(H2,21,22,28) |
| InChIKey | AVFHEOYKGJPRGX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|