C17H20ClN3O3S2 — CID 100749935
1-[2-(2-chlorophenoxy)ethyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea (PubChem CID 100749935) has the molecular formula C17H20ClN3O3S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 1-[2-(2-chlorophenoxy)ethyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea.
| Compound Name | 1-[2-(2-chlorophenoxy)ethyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 100749935 |
| Molecular Formula | C17H20ClN3O3S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 1-[2-(2-chlorophenoxy)ethyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
| SMILES | CN(c1cccc(NC(=S)NCCOc2ccccc2Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H20ClN3O3S2/c1-21(26(2,22)23)14-7-5-6-13(12-14)20-17(25)19-10-11-24-16-9-4-3-8-15(16)18/h3-9,12H,10-11H2,1-2H3,(H2,19,20,25) |
| InChIKey | SRGOHPMUTCHVCM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|