C19H24FN3O2S3 — CID 100698893
1-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea (PubChem CID 100698893) has the molecular formula C19H24FN3O2S3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 1-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea.
| Compound Name | 1-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 100698893 |
| Molecular Formula | C19H24FN3O2S3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 1-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
| SMILES | CN(c1cccc(NC(=S)NCCCSCc2ccc(F)cc2)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H24FN3O2S3/c1-23(28(2,24)25)18-6-3-5-17(13-18)22-19(26)21-11-4-12-27-14-15-7-9-16(20)10-8-15/h3,5-10,13H,4,11-12,14H2,1-2H3,(H2,21,22,26) |
| InChIKey | GJSGYFZXSAPLPL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|