C20H28N4O2S2 — CID 100753326
1-[2-(N-ethyl-4-methylanilino)ethyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea (PubChem CID 100753326) has the molecular formula C20H28N4O2S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 1-[2-(N-ethyl-4-methylanilino)ethyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea.
| Compound Name | 1-[2-(N-ethyl-4-methylanilino)ethyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 100753326 |
| Molecular Formula | C20H28N4O2S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-[2-(N-ethyl-4-methylanilino)ethyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
| SMILES | CCN(CCNC(=S)Nc1cccc(N(C)S(C)(=O)=O)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H28N4O2S2/c1-5-24(18-11-9-16(2)10-12-18)14-13-21-20(27)22-17-7-6-8-19(15-17)23(3)28(4,25)26/h6-12,15H,5,13-14H2,1-4H3,(H2,21,22,27) |
| InChIKey | ORPWZUNKEZSBIB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|