C19H24BrN3S — CID 100753254
1-(4-bromo-3-methylphenyl)-3-[2-(N-ethyl-4-methylanilino)ethyl]thiourea (PubChem CID 100753254) has the molecular formula C19H24BrN3S and a molecular weight of 406.39 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[2-(N-ethyl-4-methylanilino)ethyl]thiourea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[2-(N-ethyl-4-methylanilino)ethyl]thiourea |
|---|---|
| PubChem CID | 100753254 |
| Molecular Formula | C19H24BrN3S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[2-(N-ethyl-4-methylanilino)ethyl]thiourea |
| SMILES | CCN(CCNC(=S)Nc1ccc(Br)c(C)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H24BrN3S/c1-4-23(17-8-5-14(2)6-9-17)12-11-21-19(24)22-16-7-10-18(20)15(3)13-16/h5-10,13H,4,11-12H2,1-3H3,(H2,21,22,24) |
| InChIKey | AHHQOATYIIHQER-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|