C19H25N3OS — CID 23880334
1-(3,5-dimethylphenyl)-3-[4-[ethyl(2-hydroxyethyl)amino]phenyl]thiourea (PubChem CID 23880334) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[4-[ethyl(2-hydroxyethyl)amino]phenyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[4-[ethyl(2-hydroxyethyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 23880334 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[4-[ethyl(2-hydroxyethyl)amino]phenyl]thiourea |
| SMILES | CCN(CCO)c1ccc(NC(=S)Nc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C19H25N3OS/c1-4-22(9-10-23)18-7-5-16(6-8-18)20-19(24)21-17-12-14(2)11-15(3)13-17/h5-8,11-13,23H,4,9-10H2,1-3H3,(H2,20,21,24) |
| InChIKey | KDANWBYRETVILC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|