C17H20BrN3S — CID 100753736
1-(4-bromophenyl)-3-[2-(N,4-dimethylanilino)ethyl]thiourea (PubChem CID 100753736) has the molecular formula C17H20BrN3S and a molecular weight of 378.34 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[2-(N,4-dimethylanilino)ethyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[2-(N,4-dimethylanilino)ethyl]thiourea |
|---|---|
| PubChem CID | 100753736 |
| Molecular Formula | C17H20BrN3S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 1-(4-bromophenyl)-3-[2-(N,4-dimethylanilino)ethyl]thiourea |
| SMILES | Cc1ccc(N(C)CCNC(=S)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H20BrN3S/c1-13-3-9-16(10-4-13)21(2)12-11-19-17(22)20-15-7-5-14(18)6-8-15/h3-10H,11-12H2,1-2H3,(H2,19,20,22) |
| InChIKey | PFWCTUFVIAFUMS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|