C20H27N3OS — CID 100754053
1-[2-(N,4-dimethylanilino)ethyl]-3-(4-propan-2-yloxyphenyl)thiourea (PubChem CID 100754053) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-[2-(N,4-dimethylanilino)ethyl]-3-(4-propan-2-yloxyphenyl)thiourea.
| Compound Name | 1-[2-(N,4-dimethylanilino)ethyl]-3-(4-propan-2-yloxyphenyl)thiourea |
|---|---|
| PubChem CID | 100754053 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-[2-(N,4-dimethylanilino)ethyl]-3-(4-propan-2-yloxyphenyl)thiourea |
| SMILES | Cc1ccc(N(C)CCNC(=S)Nc2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H27N3OS/c1-15(2)24-19-11-7-17(8-12-19)22-20(25)21-13-14-23(4)18-9-5-16(3)6-10-18/h5-12,15H,13-14H2,1-4H3,(H2,21,22,25) |
| InChIKey | QSTSJJIZCKVOSI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|