C16H20N4S — CID 100754175
1-[2-(N,4-dimethylanilino)ethyl]-3-pyridin-4-ylthiourea (PubChem CID 100754175) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-[2-(N,4-dimethylanilino)ethyl]-3-pyridin-4-ylthiourea.
| Compound Name | 1-[2-(N,4-dimethylanilino)ethyl]-3-pyridin-4-ylthiourea |
|---|---|
| PubChem CID | 100754175 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[2-(N,4-dimethylanilino)ethyl]-3-pyridin-4-ylthiourea |
| SMILES | Cc1ccc(N(C)CCNC(=S)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C16H20N4S/c1-13-3-5-15(6-4-13)20(2)12-11-18-16(21)19-14-7-9-17-10-8-14/h3-10H,11-12H2,1-2H3,(H2,17,18,19,21) |
| InChIKey | VOCGDIYCWUHBGF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|