C17H19BrClN3OS — CID 100754501
1-(4-bromo-3-chlorophenyl)-3-[2-(4-methoxy-N-methylanilino)ethyl]thiourea (PubChem CID 100754501) has the molecular formula C17H19BrClN3OS and a molecular weight of 428.78 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-[2-(4-methoxy-N-methylanilino)ethyl]thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-[2-(4-methoxy-N-methylanilino)ethyl]thiourea |
|---|---|
| PubChem CID | 100754501 |
| Molecular Formula | C17H19BrClN3OS |
| Molecular Weight | 428.78 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-[2-(4-methoxy-N-methylanilino)ethyl]thiourea |
| SMILES | COc1ccc(N(C)CCNC(=S)Nc2ccc(Br)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H19BrClN3OS/c1-22(13-4-6-14(23-2)7-5-13)10-9-20-17(24)21-12-3-8-15(18)16(19)11-12/h3-8,11H,9-10H2,1-2H3,(H2,20,21,24) |
| InChIKey | AXZBIAHDUGDHGF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|