C20H24ClN3O3S — CID 100754623
ethyl 2-chloro-4-[2-(4-methoxy-N-methylanilino)ethylcarbamothioylamino]benzoate (PubChem CID 100754623) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is ethyl 2-chloro-4-[2-(4-methoxy-N-methylanilino)ethylcarbamothioylamino]benzoate.
| Compound Name | ethyl 2-chloro-4-[2-(4-methoxy-N-methylanilino)ethylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100754623 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | ethyl 2-chloro-4-[2-(4-methoxy-N-methylanilino)ethylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NCCN(C)c2ccc(OC)cc2)cc1Cl |
| InChI | InChI=1S/C20H24ClN3O3S/c1-4-27-19(25)17-10-5-14(13-18(17)21)23-20(28)22-11-12-24(2)15-6-8-16(26-3)9-7-15/h5-10,13H,4,11-12H2,1-3H3,(H2,22,23,28) |
| InChIKey | HKIBQVINMWYLCM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_B(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|