C18H19ClN2O3S — CID 100591636
ethyl 2-chloro-5-[(4-methoxyphenyl)methylcarbamothioylamino]benzoate (PubChem CID 100591636) has the molecular formula C18H19ClN2O3S and a molecular weight of 378.88 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(4-methoxyphenyl)methylcarbamothioylamino]benzoate.
| Compound Name | ethyl 2-chloro-5-[(4-methoxyphenyl)methylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100591636 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | ethyl 2-chloro-5-[(4-methoxyphenyl)methylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=S)NCc2ccc(OC)cc2)ccc1Cl |
| InChI | InChI=1S/C18H19ClN2O3S/c1-3-24-17(22)15-10-13(6-9-16(15)19)21-18(25)20-11-12-4-7-14(23-2)8-5-12/h4-10H,3,11H2,1-2H3,(H2,20,21,25) |
| InChIKey | FYZQKPBDLXTLKK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|