C22H25ClN2O4S — CID 133216093
ethyl 2-chloro-5-[(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamothioylamino]benzoate (PubChem CID 133216093) has the molecular formula C22H25ClN2O4S and a molecular weight of 448.97 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamothioylamino]benzoate.
| Compound Name | ethyl 2-chloro-5-[(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 133216093 |
| Molecular Formula | C22H25ClN2O4S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | ethyl 2-chloro-5-[(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=S)NC2CC(C)(C)Oc3cc(OC)ccc32)ccc1Cl |
| InChI | InChI=1S/C22H25ClN2O4S/c1-5-28-20(26)16-10-13(6-9-17(16)23)24-21(30)25-18-12-22(2,3)29-19-11-14(27-4)7-8-15(18)19/h6-11,18H,5,12H2,1-4H3,(H2,24,25,30) |
| InChIKey | MDUAWSQOHJDHNM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|