C23H28N2O4S — CID 133216017
ethyl 3-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamothioylamino]-2-methylbenzoate (PubChem CID 133216017) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is ethyl 3-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamothioylamino]-2-methylbenzoate.
| Compound Name | ethyl 3-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamothioylamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 133216017 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | ethyl 3-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)carbamothioylamino]-2-methylbenzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NC2CC(C)(C)Oc3ccc(OC)cc32)c1C |
| InChI | InChI=1S/C23H28N2O4S/c1-6-28-21(26)16-8-7-9-18(14(16)2)24-22(30)25-19-13-23(3,4)29-20-11-10-15(27-5)12-17(19)20/h7-12,19H,6,13H2,1-5H3,(H2,24,25,30) |
| InChIKey | WKPGTPWLHCTGFF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|