C19H20BrFN2O2S — CID 133216010
1-(4-bromo-2-fluorophenyl)-3-(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)thiourea (PubChem CID 133216010) has the molecular formula C19H20BrFN2O2S and a molecular weight of 439.35 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)thiourea |
|---|---|
| PubChem CID | 133216010 |
| Molecular Formula | C19H20BrFN2O2S |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)thiourea |
| SMILES | COc1ccc2c(c1)C(NC(=S)Nc1ccc(Br)cc1F)CC(C)(C)O2 |
| InChI | InChI=1S/C19H20BrFN2O2S/c1-19(2)10-16(13-9-12(24-3)5-7-17(13)25-19)23-18(26)22-15-6-4-11(20)8-14(15)21/h4-9,16H,10H2,1-3H3,(H2,22,23,26) |
| InChIKey | QAKBVBONOUATKC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|