C20H23ClN2O3S — CID 100721045
1-(3-chloro-4-methoxyphenyl)-3-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea (PubChem CID 100721045) has the molecular formula C20H23ClN2O3S and a molecular weight of 406.94 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea |
|---|---|
| PubChem CID | 100721045 |
| Molecular Formula | C20H23ClN2O3S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]thiourea |
| SMILES | COc1ccc2c(c1)[C@H](NC(=S)Nc1ccc(OC)c(Cl)c1)CC(C)(C)O2 |
| InChI | InChI=1S/C20H23ClN2O3S/c1-20(2)11-16(14-10-13(24-3)6-8-17(14)26-20)23-19(27)22-12-5-7-18(25-4)15(21)9-12/h5-10,16H,11H2,1-4H3,(H2,22,23,27)/t16-/m1/s1 |
| InChIKey | QNLOZVJDUVELQU-MRXNPFEDSA-N |
| XLogP | 4.95 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|