C19H23N3O3S — CID 100723441
1-[(4S)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-(6-methoxy-3-pyridinyl)thiourea (PubChem CID 100723441) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[(4S)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-(6-methoxy-3-pyridinyl)thiourea.
| Compound Name | 1-[(4S)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-(6-methoxy-3-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100723441 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[(4S)-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-(6-methoxy-3-pyridinyl)thiourea |
| SMILES | COc1ccc2c(c1)OC(C)(C)C[C@@H]2NC(=S)Nc1ccc(OC)nc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-19(2)10-15(14-7-6-13(23-3)9-16(14)25-19)22-18(26)21-12-5-8-17(24-4)20-11-12/h5-9,11,15H,10H2,1-4H3,(H2,21,22,26)/t15-/m0/s1 |
| InChIKey | KOVFJPKPORPBBN-HNNXBMFYSA-N |
| XLogP | 3.69 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|