C19H23N3O2S — CID 100719154
1-(6-methoxy-3-pyridinyl)-3-[(4S)-2,2,6-trimethyl-3,4-dihydrochromen-4-yl]thiourea (PubChem CID 100719154) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-(6-methoxy-3-pyridinyl)-3-[(4S)-2,2,6-trimethyl-3,4-dihydrochromen-4-yl]thiourea.
| Compound Name | 1-(6-methoxy-3-pyridinyl)-3-[(4S)-2,2,6-trimethyl-3,4-dihydrochromen-4-yl]thiourea |
|---|---|
| PubChem CID | 100719154 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-(6-methoxy-3-pyridinyl)-3-[(4S)-2,2,6-trimethyl-3,4-dihydrochromen-4-yl]thiourea |
| SMILES | COc1ccc(NC(=S)N[C@H]2CC(C)(C)Oc3ccc(C)cc32)cn1 |
| InChI | InChI=1S/C19H23N3O2S/c1-12-5-7-16-14(9-12)15(10-19(2,3)24-16)22-18(25)21-13-6-8-17(23-4)20-11-13/h5-9,11,15H,10H2,1-4H3,(H2,21,22,25)/t15-/m0/s1 |
| InChIKey | KUUJUECJSYIHOB-HNNXBMFYSA-N |
| XLogP | 3.99 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|