C18H21N3OS — CID 133215895
1-pyridin-4-yl-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea (PubChem CID 133215895) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-pyridin-4-yl-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea.
| Compound Name | 1-pyridin-4-yl-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
|---|---|
| PubChem CID | 133215895 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-pyridin-4-yl-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
| SMILES | Cc1ccc2c(c1)C(NC(=S)Nc1ccncc1)CC(C)(C)O2 |
| InChI | InChI=1S/C18H21N3OS/c1-12-4-5-16-14(10-12)15(11-18(2,3)22-16)21-17(23)20-13-6-8-19-9-7-13/h4-10,15H,11H2,1-3H3,(H2,19,20,21,23) |
| InChIKey | AQVZALBDBWFAKF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|