C19H23N3OS — CID 133215890
1-(3-methyl-2-pyridinyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea (PubChem CID 133215890) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-(3-methyl-2-pyridinyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea.
| Compound Name | 1-(3-methyl-2-pyridinyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
|---|---|
| PubChem CID | 133215890 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-(3-methyl-2-pyridinyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
| SMILES | Cc1ccc2c(c1)C(NC(=S)Nc1ncccc1C)CC(C)(C)O2 |
| InChI | InChI=1S/C19H23N3OS/c1-12-7-8-16-14(10-12)15(11-19(3,4)23-16)21-18(24)22-17-13(2)6-5-9-20-17/h5-10,15H,11H2,1-4H3,(H2,20,21,22,24) |
| InChIKey | RWPCQINYTKPQOK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|