C23H25N3O2S — CID 133215898
1-(8-methoxyquinolin-5-yl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea (PubChem CID 133215898) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 1-(8-methoxyquinolin-5-yl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea.
| Compound Name | 1-(8-methoxyquinolin-5-yl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
|---|---|
| PubChem CID | 133215898 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-(8-methoxyquinolin-5-yl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
| SMILES | COc1ccc(NC(=S)NC2CC(C)(C)Oc3ccc(C)cc32)c2cccnc12 |
| InChI | InChI=1S/C23H25N3O2S/c1-14-7-9-19-16(12-14)18(13-23(2,3)28-19)26-22(29)25-17-8-10-20(27-4)21-15(17)6-5-11-24-21/h5-12,18H,13H2,1-4H3,(H2,25,26,29) |
| InChIKey | MKNHFOQVTGBDOZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|