C21H26N2OS — CID 133155102
1-(3,4-dimethylphenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea (PubChem CID 133155102) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
|---|---|
| PubChem CID | 133155102 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
| SMILES | Cc1ccc2c(c1)C(NC(=S)Nc1ccc(C)c(C)c1)CC(C)(C)O2 |
| InChI | InChI=1S/C21H26N2OS/c1-13-6-9-19-17(10-13)18(12-21(4,5)24-19)23-20(25)22-16-8-7-14(2)15(3)11-16/h6-11,18H,12H2,1-5H3,(H2,22,23,25) |
| InChIKey | VEMSZOWBEWJBQW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|