C19H21BrN2OS — CID 133155107
1-(3-bromophenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea (PubChem CID 133155107) has the molecular formula C19H21BrN2OS and a molecular weight of 405.36 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea.
| Compound Name | 1-(3-bromophenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
|---|---|
| PubChem CID | 133155107 |
| Molecular Formula | C19H21BrN2OS |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)thiourea |
| SMILES | Cc1ccc2c(c1)C(NC(=S)Nc1cccc(Br)c1)CC(C)(C)O2 |
| InChI | InChI=1S/C19H21BrN2OS/c1-12-7-8-17-15(9-12)16(11-19(2,3)23-17)22-18(24)21-14-6-4-5-13(20)10-14/h4-10,16H,11H2,1-3H3,(H2,21,22,24) |
| InChIKey | XVXDSZQEYPODOF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|