C19H21ClN2O2 — CID 132652579
1-(3-chlorophenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)urea (PubChem CID 132652579) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)urea |
|---|---|
| PubChem CID | 132652579 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)urea |
| SMILES | Cc1ccc2c(c1)C(NC(=O)Nc1cccc(Cl)c1)CC(C)(C)O2 |
| InChI | InChI=1S/C19H21ClN2O2/c1-12-7-8-17-15(9-12)16(11-19(2,3)24-17)22-18(23)21-14-6-4-5-13(20)10-14/h4-10,16H,11H2,1-3H3,(H2,21,22,23) |
| InChIKey | JEGNXUWAZOPQKS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |