C18H19ClN2O2 — CID 94052781
1-(4-chlorophenyl)-3-[(4R)-2,2-dimethyl-3,4-dihydrochromen-4-yl]urea (PubChem CID 94052781) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4R)-2,2-dimethyl-3,4-dihydrochromen-4-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4R)-2,2-dimethyl-3,4-dihydrochromen-4-yl]urea |
|---|---|
| PubChem CID | 94052781 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4R)-2,2-dimethyl-3,4-dihydrochromen-4-yl]urea |
| SMILES | CC1(C)C[C@@H](NC(=O)Nc2ccc(Cl)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C18H19ClN2O2/c1-18(2)11-15(14-5-3-4-6-16(14)23-18)21-17(22)20-13-9-7-12(19)8-10-13/h3-10,15H,11H2,1-2H3,(H2,20,21,22)/t15-/m1/s1 |
| InChIKey | SVECGYNXELOJSD-OAHLLOKOSA-N |
| XLogP | 4.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |