C20H23ClN2OS — CID 100642276
1-(4-chlorophenyl)-3-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]thiourea (PubChem CID 100642276) has the molecular formula C20H23ClN2OS and a molecular weight of 374.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]thiourea |
|---|---|
| PubChem CID | 100642276 |
| Molecular Formula | C20H23ClN2OS |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]thiourea |
| SMILES | CCC1(CC)C[C@H](NC(=S)Nc2ccc(Cl)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C20H23ClN2OS/c1-3-20(4-2)13-17(16-7-5-6-8-18(16)24-20)23-19(25)22-15-11-9-14(21)10-12-15/h5-12,17H,3-4,13H2,1-2H3,(H2,22,23,25)/t17-/m0/s1 |
| InChIKey | QIEAUOCQBIUCRQ-KRWDZBQOSA-N |
| XLogP | 5.71 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|