C20H21BrClNO2 — CID 100537655
5-bromo-2-chloro-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]benzamide (PubChem CID 100537655) has the molecular formula C20H21BrClNO2 and a molecular weight of 422.75 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]benzamide |
|---|---|
| PubChem CID | 100537655 |
| Molecular Formula | C20H21BrClNO2 |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 5-bromo-2-chloro-N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]benzamide |
| SMILES | CCC1(CC)C[C@@H](NC(=O)c2cc(Br)ccc2Cl)c2ccccc2O1 |
| InChI | InChI=1S/C20H21BrClNO2/c1-3-20(4-2)12-17(14-7-5-6-8-18(14)25-20)23-19(24)15-11-13(21)9-10-16(15)22/h5-11,17H,3-4,12H2,1-2H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | JLYKRBJPRIXNCH-QGZVFWFLSA-N |
| XLogP | 5.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |