C18H17BrClNO2 — CID 133164751
5-bromo-2-chloro-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)benzamide (PubChem CID 133164751) has the molecular formula C18H17BrClNO2 and a molecular weight of 394.70 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)benzamide.
| Compound Name | 5-bromo-2-chloro-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)benzamide |
|---|---|
| PubChem CID | 133164751 |
| Molecular Formula | C18H17BrClNO2 |
| Molecular Weight | 394.70 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 5-bromo-2-chloro-N-(2,2-dimethyl-3,4-dihydrochromen-4-yl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2cc(Br)ccc2Cl)c2ccccc2O1 |
| InChI | InChI=1S/C18H17BrClNO2/c1-18(2)10-15(12-5-3-4-6-16(12)23-18)21-17(22)13-9-11(19)7-8-14(13)20/h3-9,15H,10H2,1-2H3,(H,21,22) |
| InChIKey | FOIZLNDMNQATBB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.70 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |