C17H23NO2 — CID 100609810
N-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]cyclopropanecarboxamide (PubChem CID 100609810) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 100609810 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]cyclopropanecarboxamide |
| SMILES | CCC1(CC)C[C@H](NC(=O)C2CC2)c2ccccc2O1 |
| InChI | InChI=1S/C17H23NO2/c1-3-17(4-2)11-14(18-16(19)12-9-10-12)13-7-5-6-8-15(13)20-17/h5-8,12,14H,3-4,9-11H2,1-2H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | SBRSLHSWZXWAIZ-AWEZNQCLSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |