C20H29NO2 — CID 133256868
N-(2,2-diethyl-3,4-dihydrochromen-4-yl)cyclohexanecarboxamide (PubChem CID 133256868) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(2,2-diethyl-3,4-dihydrochromen-4-yl)cyclohexanecarboxamide.
| Compound Name | N-(2,2-diethyl-3,4-dihydrochromen-4-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 133256868 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-(2,2-diethyl-3,4-dihydrochromen-4-yl)cyclohexanecarboxamide |
| SMILES | CCC1(CC)CC(NC(=O)C2CCCCC2)c2ccccc2O1 |
| InChI | InChI=1S/C20H29NO2/c1-3-20(4-2)14-17(16-12-8-9-13-18(16)23-20)21-19(22)15-10-6-5-7-11-15/h8-9,12-13,15,17H,3-7,10-11,14H2,1-2H3,(H,21,22) |
| InChIKey | SWOCAGZUBPRQPL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |