C22H27NO2S — CID 133235655
2-benzylsulfanyl-N-(2,2-diethyl-3,4-dihydrochromen-4-yl)acetamide (PubChem CID 133235655) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(2,2-diethyl-3,4-dihydrochromen-4-yl)acetamide.
| Compound Name | 2-benzylsulfanyl-N-(2,2-diethyl-3,4-dihydrochromen-4-yl)acetamide |
|---|---|
| PubChem CID | 133235655 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-benzylsulfanyl-N-(2,2-diethyl-3,4-dihydrochromen-4-yl)acetamide |
| SMILES | CCC1(CC)CC(NC(=O)CSCc2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C22H27NO2S/c1-3-22(4-2)14-19(18-12-8-9-13-20(18)25-22)23-21(24)16-26-15-17-10-6-5-7-11-17/h5-13,19H,3-4,14-16H2,1-2H3,(H,23,24) |
| InChIKey | OLNGHTIULMELMD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |