C20H23ClN2O2 — CID 100690269
1-(4-chlorophenyl)-3-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]urea (PubChem CID 100690269) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]urea |
|---|---|
| PubChem CID | 100690269 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]urea |
| SMILES | CCC1(CC)C[C@H](NC(=O)Nc2ccc(Cl)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-3-20(4-2)13-17(16-7-5-6-8-18(16)25-20)23-19(24)22-15-11-9-14(21)10-12-15/h5-12,17H,3-4,13H2,1-2H3,(H2,22,23,24)/t17-/m0/s1 |
| InChIKey | JFMAWOZMKRJORE-KRWDZBQOSA-N |
| XLogP | 5.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |