C22H23ClN4O4S2 — CID 133200254
4-chloro-N-[5-[(2,2-diethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 133200254) has the molecular formula C22H23ClN4O4S2 and a molecular weight of 507.04 g/mol. Its IUPAC name is 4-chloro-N-[5-[(2,2-diethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[(2,2-diethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 133200254 |
| Molecular Formula | C22H23ClN4O4S2 |
| Molecular Weight | 507.04 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 4-chloro-N-[5-[(2,2-diethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCC1(CC)CC(NS(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3)s2)c2ccccc2O1 |
| InChI | InChI=1S/C22H23ClN4O4S2/c1-3-22(4-2)13-17(16-7-5-6-8-18(16)31-22)27-33(29,30)21-26-25-20(32-21)24-19(28)14-9-11-15(23)12-10-14/h5-12,17,27H,3-4,13H2,1-2H3,(H,24,25,28) |
| InChIKey | JKXXDTYYTXEOOG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.04 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|