C17H22N4O4S2 — CID 100531035
N-[5-[[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 100531035) has the molecular formula C17H22N4O4S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[5-[[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-[[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 100531035 |
| Molecular Formula | C17H22N4O4S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[5-[[(4S)-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1nnc(S(=O)(=O)N[C@H]2CC(C)(C)Oc3ccccc32)s1 |
| InChI | InChI=1S/C17H22N4O4S2/c1-10(2)14(22)18-15-19-20-16(26-15)27(23,24)21-12-9-17(3,4)25-13-8-6-5-7-11(12)13/h5-8,10,12,21H,9H2,1-4H3,(H,18,19,22)/t12-/m0/s1 |
| InChIKey | SMMDOZSZSGZQPJ-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|