C22H24N4O5S2 — CID 133167610
N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide (PubChem CID 133167610) has the molecular formula C22H24N4O5S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 133167610 |
| Molecular Formula | C22H24N4O5S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
| SMILES | COc1ccc2c(c1)C(NS(=O)(=O)c1nnc(NC(=O)c3ccc(C)cc3)s1)CC(C)(C)O2 |
| InChI | InChI=1S/C22H24N4O5S2/c1-13-5-7-14(8-6-13)19(27)23-20-24-25-21(32-20)33(28,29)26-17-12-22(2,3)31-18-10-9-15(30-4)11-16(17)18/h5-11,17,26H,12H2,1-4H3,(H,23,24,27) |
| InChIKey | LAVJRGHLPYWFGH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|