C19H26N4O5S2 — CID 100754686
N-[5-[[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 100754686) has the molecular formula C19H26N4O5S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-[5-[[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100754686 |
| Molecular Formula | C19H26N4O5S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[5-[[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc2c(c1)[C@H](NS(=O)(=O)c1nnc(NC(=O)C(C)(C)C)s1)CC(C)(C)O2 |
| InChI | InChI=1S/C19H26N4O5S2/c1-18(2,3)15(24)20-16-21-22-17(29-16)30(25,26)23-13-10-19(4,5)28-14-8-7-11(27-6)9-12(13)14/h7-9,13,23H,10H2,1-6H3,(H,20,21,24)/t13-/m1/s1 |
| InChIKey | RAFJXXKEWZFPIY-CYBMUJFWSA-N |
| XLogP | 3.11 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|