C21H21ClN4O5S2 — CID 100515170
4-chloro-N-[5-[[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100515170) has the molecular formula C21H21ClN4O5S2 and a molecular weight of 509.01 g/mol. Its IUPAC name is 4-chloro-N-[5-[[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100515170 |
| Molecular Formula | C21H21ClN4O5S2 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | 4-chloro-N-[5-[[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc2c(c1)[C@H](NS(=O)(=O)c1nnc(NC(=O)c3ccc(Cl)cc3)s1)CC(C)(C)O2 |
| InChI | InChI=1S/C21H21ClN4O5S2/c1-21(2)11-16(15-10-14(30-3)8-9-17(15)31-21)26-33(28,29)20-25-24-19(32-20)23-18(27)12-4-6-13(22)7-5-12/h4-10,16,26H,11H2,1-3H3,(H,23,24,27)/t16-/m1/s1 |
| InChIKey | UCASYMJSMLAQMU-MRXNPFEDSA-N |
| XLogP | 4.03 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|