C17H22N4O5S2 — CID 133162962
N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 133162962) has the molecular formula C17H22N4O5S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 133162962 |
| Molecular Formula | C17H22N4O5S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)Nc1nnc(S(=O)(=O)NC2CC(C)(C)Oc3ccc(OC)cc32)s1 |
| InChI | InChI=1S/C17H22N4O5S2/c1-5-14(22)18-15-19-20-16(27-15)28(23,24)21-12-9-17(2,3)26-13-7-6-10(25-4)8-11(12)13/h6-8,12,21H,5,9H2,1-4H3,(H,18,19,22) |
| InChIKey | HWQIAJSBXWJZRC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|