C21H20Cl2N4O5S2 — CID 133186904
2,4-dichloro-N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 133186904) has the molecular formula C21H20Cl2N4O5S2 and a molecular weight of 543.45 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 133186904 |
| Molecular Formula | C21H20Cl2N4O5S2 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | 2,4-dichloro-N-[5-[(6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc2c(c1)C(NS(=O)(=O)c1nnc(NC(=O)c3ccc(Cl)cc3Cl)s1)CC(C)(C)O2 |
| InChI | InChI=1S/C21H20Cl2N4O5S2/c1-21(2)10-16(14-9-12(31-3)5-7-17(14)32-21)27-34(29,30)20-26-25-19(33-20)24-18(28)13-6-4-11(22)8-15(13)23/h4-9,16,27H,10H2,1-3H3,(H,24,25,28) |
| InChIKey | ROCQJPIWNOASPV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|