C23H23ClN4O4S2 — CID 100540361
2-chloro-N-[5-[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100540361) has the molecular formula C23H23ClN4O4S2 and a molecular weight of 519.05 g/mol. Its IUPAC name is 2-chloro-N-[5-[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100540361 |
| Molecular Formula | C23H23ClN4O4S2 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 2-chloro-N-[5-[[(4S)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)N[C@H]2CC3(CCCCC3)Oc3ccccc32)s1)c1ccccc1Cl |
| InChI | InChI=1S/C23H23ClN4O4S2/c24-17-10-4-2-8-15(17)20(29)25-21-26-27-22(33-21)34(30,31)28-18-14-23(12-6-1-7-13-23)32-19-11-5-3-9-16(18)19/h2-5,8-11,18,28H,1,6-7,12-14H2,(H,25,26,29)/t18-/m0/s1 |
| InChIKey | IRJGQDKWPJEPHX-SFHVURJKSA-N |
| XLogP | 4.95 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|