C19H18Cl2N4O5S2 — CID 100713351
2,4-dichloro-N-[5-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100713351) has the molecular formula C19H18Cl2N4O5S2 and a molecular weight of 517.42 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100713351 |
| Molecular Formula | C19H18Cl2N4O5S2 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | 2,4-dichloro-N-[5-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(OC[C@@H](C)NS(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3Cl)s2)cc1 |
| InChI | InChI=1S/C19H18Cl2N4O5S2/c1-11(10-30-14-6-4-13(29-2)5-7-14)25-32(27,28)19-24-23-18(31-19)22-17(26)15-8-3-12(20)9-16(15)21/h3-9,11,25H,10H2,1-2H3,(H,22,23,26)/t11-/m1/s1 |
| InChIKey | WDOWYBKOHVTYPE-LLVKDONJSA-N |
| XLogP | 3.85 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|