C19H20N4O5S2 — CID 100565619
N-[5-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100565619) has the molecular formula C19H20N4O5S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[5-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100565619 |
| Molecular Formula | C19H20N4O5S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N-[5-[[(2R)-1-(4-methoxyphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(OC[C@@H](C)NS(=O)(=O)c2nnc(NC(=O)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C19H20N4O5S2/c1-13(12-28-16-10-8-15(27-2)9-11-16)23-30(25,26)19-22-21-18(29-19)20-17(24)14-6-4-3-5-7-14/h3-11,13,23H,12H2,1-2H3,(H,20,21,24)/t13-/m1/s1 |
| InChIKey | VSHOHEOMNNCLII-CYBMUJFWSA-N |
| XLogP | 2.54 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|