C19H19ClN4O4S2 — CID 100625323
2-chloro-N-[5-[[(2R)-1-(4-methylphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100625323) has the molecular formula C19H19ClN4O4S2 and a molecular weight of 466.97 g/mol. Its IUPAC name is 2-chloro-N-[5-[[(2R)-1-(4-methylphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[5-[[(2R)-1-(4-methylphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100625323 |
| Molecular Formula | C19H19ClN4O4S2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 2-chloro-N-[5-[[(2R)-1-(4-methylphenoxy)propan-2-yl]sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(OC[C@@H](C)NS(=O)(=O)c2nnc(NC(=O)c3ccccc3Cl)s2)cc1 |
| InChI | InChI=1S/C19H19ClN4O4S2/c1-12-7-9-14(10-8-12)28-11-13(2)24-30(26,27)19-23-22-18(29-19)21-17(25)15-5-3-4-6-16(15)20/h3-10,13,24H,11H2,1-2H3,(H,21,22,25)/t13-/m1/s1 |
| InChIKey | JPPPUNXKKJPVKX-CYBMUJFWSA-N |
| XLogP | 3.50 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|