C20H21ClN4O4S2 — CID 133265247
4-chloro-N-[5-[1-(3,4-dimethylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 133265247) has the molecular formula C20H21ClN4O4S2 and a molecular weight of 481.00 g/mol. Its IUPAC name is 4-chloro-N-[5-[1-(3,4-dimethylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-chloro-N-[5-[1-(3,4-dimethylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 133265247 |
| Molecular Formula | C20H21ClN4O4S2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 4-chloro-N-[5-[1-(3,4-dimethylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccc(OCC(C)NS(=O)(=O)c2nnc(NC(=O)c3ccc(Cl)cc3)s2)cc1C |
| InChI | InChI=1S/C20H21ClN4O4S2/c1-12-4-9-17(10-13(12)2)29-11-14(3)25-31(27,28)20-24-23-19(30-20)22-18(26)15-5-7-16(21)8-6-15/h4-10,14,25H,11H2,1-3H3,(H,22,23,26) |
| InChIKey | INOSYCCPFHVAFW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|