C18H26N4O4S2 — CID 133161502
N-[5-[1-(3,4-dimethylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide (PubChem CID 133161502) has the molecular formula C18H26N4O4S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[5-[1-(3,4-dimethylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[1-(3,4-dimethylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 133161502 |
| Molecular Formula | C18H26N4O4S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[5-[1-(3,4-dimethylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]-2,2-dimethylpropanamide |
| SMILES | Cc1ccc(OCC(C)NS(=O)(=O)c2nnc(NC(=O)C(C)(C)C)s2)cc1C |
| InChI | InChI=1S/C18H26N4O4S2/c1-11-7-8-14(9-12(11)2)26-10-13(3)22-28(24,25)17-21-20-16(27-17)19-15(23)18(4,5)6/h7-9,13,22H,10H2,1-6H3,(H,19,20,23) |
| InChIKey | UHZPHUZOWHXHDT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|