C17H24N4O4S2 — CID 133199633
2,2-dimethyl-N-[5-[1-(2-methylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 133199633) has the molecular formula C17H24N4O4S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 2,2-dimethyl-N-[5-[1-(2-methylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[5-[1-(2-methylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 133199633 |
| Molecular Formula | C17H24N4O4S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2,2-dimethyl-N-[5-[1-(2-methylphenoxy)propan-2-ylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | Cc1ccccc1OCC(C)NS(=O)(=O)c1nnc(NC(=O)C(C)(C)C)s1 |
| InChI | InChI=1S/C17H24N4O4S2/c1-11-8-6-7-9-13(11)25-10-12(2)21-27(23,24)16-20-19-15(26-16)18-14(22)17(3,4)5/h6-9,12,21H,10H2,1-5H3,(H,18,19,22) |
| InChIKey | WLRFUYGZYPLNOO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|